![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | thankyou.fmb | 2023-10-21 05:37 | 6.0K | |
| mouth.pmb | 2023-10-21 05:37 | 51K | |
| game.pmb | 2023-10-21 05:37 | 35K | |
| OPENING - Evil Awakening.eup | 2023-10-21 05:37 | 20K | |
| MOUTH01 - sad opening.eup | 2023-10-21 05:37 | 40K | |
| GAMEOVER - Damn it.eup | 2023-10-21 05:37 | 5.5K | |
| GAME9 - Between the stars.eup | 2023-10-21 05:37 | 39K | |
| GAME8 - At the end of the earth.eup | 2023-10-21 05:37 | 18K | |
| GAME7 - Labyrinth.eup | 2023-10-21 05:37 | 23K | |
| GAME6 - Where can I go.eup | 2023-10-21 05:37 | 25K | |
| GAME5 - Regret.eup | 2023-10-21 05:37 | 17K | |
| GAME4 - Wind.eup | 2023-10-21 05:37 | 11K | |
| GAME3 - I chi ge ki.eup | 2023-10-21 05:37 | 22K | |
| GAME2 - backwater formation.eup | 2023-10-21 05:37 | 33K | |
| GAME10 - Zombie.eup | 2023-10-21 05:37 | 56K | |
| GAME1 - Yaminonakade.eup | 2023-10-21 05:37 | 21K | |
| ENDING - Natural Harts.eup | 2023-10-21 05:37 | 27K | |
| CLEAR - Alright.eup | 2023-10-21 05:37 | 5.1K | |
|
|---|