![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Zootto Mahjong/ | 2008-10-13 17:34 | - | |
| Zoop/ | 2008-07-05 10:12 | - | |
| Zero - The Kamikaze Squirrel/ | 2021-05-15 07:00 | - | |
| Zen Nihon Pro Wrestling - Fight Da Pon!/ | 2008-07-08 08:29 | - | |
| Zen Nihon GT Senshuken - Hyper Battle Game/ | 2008-10-13 17:33 | - | |
| Yuujin Janjuu Gakuen/ | 2021-05-15 07:00 | - | |
| Yuu Yuu Hakusho Final - Makai Saikyou Retsuden/ | 2008-10-13 17:32 | - | |
| Yoshi No Kuruppon - Oven De Cookie/ | 2021-05-15 07:00 | - | |
| Yoshi's Cookie/ | 2009-11-15 09:26 | - | |
| YamYam/ | 2009-11-15 09:25 | - | |
| Wizap! - Ankoku No Ou/ | 2008-09-18 15:17 | - | |
| Winter Extreme - Skiing & Snowboarding/ | 2019-08-24 07:17 | - | |
| Wing Commander - The Secret Missions/ | 2008-07-05 10:10 | - | |
| Wicked 18 Golf/ | 2008-07-05 10:10 | - | |
| Whizz/ | 2008-07-05 10:10 | - | |
| Waratte Iitomo! Tamorinpic/ | 2021-05-15 07:00 | - | |
| Waku Waku Ski Wonder Shoot/ | 2021-05-15 07:00 | - | |
| WWF Raw/ | 2008-07-05 10:09 | - | |
| Vs. Collection/ | 2019-08-24 07:17 | - | |
| Virtual Bart/ | 2008-07-05 10:09 | - | |
| Untitled NFL Football Game/ | 2021-05-15 07:00 | - | |
| Uniracer/ | 2008-07-05 10:09 | - | |
| Undake 30 - Same Game Mario Version/ | 2009-11-15 09:25 | - | |
| Ultra Baseball Jitsumei Ban 3/ | 2021-05-15 07:00 | - | |
| Ultra Baseball Jitsumei Ban 2/ | 2021-05-15 07:00 | - | |
| Ultra Baseball Jitsumei Ban/ | 2021-05-15 07:00 | - | |
| Uchuu No Kishi - Tekkaman Blade/ | 2008-07-05 10:09 | - | |
| Tsuppari Oozumou - Rissin Syusse-hen/ | 2008-07-08 08:28 | - | |
| Tsukikomori/ | 2009-11-15 09:24 | - | |
| Toys/ | 2008-07-05 10:09 | - | |
| Touge Densetsu Saisoku Battle/ | 2008-10-13 17:30 | - | |
| Tottemo! Lucky Man/ | 2008-07-05 10:09 | - | |
| Total Carnage/ | 2021-05-15 07:00 | - | |
| Toride/ | 2008-07-05 10:08 | - | |
| Top Management 2/ | 2021-05-15 07:00 | - | |
| Top Gear/ | 2021-05-15 07:00 | - | |
| Tokoro's Mahjong/ | 2021-05-15 07:00 | - | |
| Tokimeki Memorial - Densetsu No Ki No Shita De/ | 2008-07-05 10:08 | - | |
| Tic-Tac-Toe/ | 2008-07-05 10:07 | - | |
| Thunderbirds - Kokusai Kyuujotai Juudou Seyo!/ | 2008-07-05 10:07 | - | |
| Thoroughbred Breeder II/ | 2008-07-05 10:07 | - | |
| The Shinri Game 3/ | 2021-05-15 07:00 | - | |
| The Shinri Game - Akuma No Kokoroji/ | 2021-05-15 07:00 | - | |
| The Shadow/ | 2008-07-05 10:07 | - | |
| The Ninja Warriors Again/ | 2008-07-05 10:06 | - | |
| The Mask/ | 2008-07-05 10:06 | - | |
| The Jetsons - Invasion Of The Planet Pirates/ | 2008-07-05 10:06 | - | |
| The Itchy & Scratchy Game/ | 2008-07-05 10:06 | - | |
| The Irem Major Title/ | 2008-07-05 10:06 | - | |
| The Ignition Factor/ | 2008-07-05 10:06 | - | |
| The Hunt For Red October/ | 2008-07-05 10:06 | - | |
| The Flintstones - The Treasure Of Sierra Madrock/ | 2008-07-05 10:06 | - | |
| The Amazing Spider-Man/ | 2008-07-05 10:06 | - | |
| Tetris Flash/ | 2008-07-05 10:05 | - | |
| Tetris 2/ | 2021-05-15 07:00 | - | |
| Tetris & Dr. Mario/ | 2021-05-15 07:00 | - | |
| Tenchi Muyou! Game Hen/ | 2008-07-05 10:05 | - | |
| Tekken 2/ | 2008-07-05 10:05 | - | |
| Teenage Mutant Ninja Turtles - Tournament Fighters/ | 2008-07-05 10:05 | - | |
| Teenage Mutant Ninja Turtles - Tournament Fighters (Beta)/ | 2008-07-05 10:05 | - | |
| Taz-Mania/ | 2008-07-05 10:05 | - | |
| Tarot Mystery/ | 2021-05-15 07:00 | - | |
| Tamagocchi Town/ | 2009-11-15 09:22 | - | |
| Taekwon-Do/ | 2021-05-15 07:00 | - | |
| TKO Super Championship Boxing/ | 2008-07-05 10:04 | - | |
| T2 - The Arcade Game/ | 2008-10-13 17:29 | - | |
| Syutoko Battle Racing 2/ | 2021-05-15 07:00 | - | |
| Swat Kats - The Radical Squadron/ | 2008-07-05 10:04 | - | |
| Super Wrestle Angels/ | 2008-09-18 15:16 | - | |
| Super Wild Card DX v1.122/ | 2021-05-15 07:00 | - | |
| Super Wild Card DX2 v1.106/ | 2009-11-15 09:22 | - | |
| Super Widget/ | 2021-05-15 07:00 | - | |
| Super Wagyan Land 2/ | 2008-09-18 15:15 | - | |
| Super Variable Geo/ | 2021-05-15 07:00 | - | |
| Super Ultra Baseball 2/ | 2021-05-15 07:00 | - | |
| Super Ultra Baseball/ | 2008-07-05 10:04 | - | |
| Super Tetris 3/ | 2021-05-15 07:00 | - | |
| Super Tetris 2 + Bombliss Limited Edition/ | 2021-05-15 07:00 | - | |
| Super Tetris 2 + Bombliss/ | 2008-07-05 10:04 | - | |
| Super Tennis/ | 2021-05-15 07:00 | - | |
| Super Soccer/ | 2008-07-05 10:03 | - | |
| Super Smash TV/ | 2021-05-15 07:00 | - | |
| Super Shougi 3 - Kitaihei/ | 2021-05-15 07:00 | - | |
| Super Shougi/ | 2021-05-15 07:00 | - | |
| Super Scope 6/ | 2008-07-05 10:03 | - | |
| Super SWIV/ | 2008-07-20 08:04 | - | |
| Super Real Mahjong PIV/ | 2008-10-13 17:28 | - | |
| Super Pang/ | 2008-07-05 10:03 | - | |
| Super Off Road - The Baja/ | 2008-07-05 10:03 | - | |
| Super Ninja Boy/ | 2008-07-05 10:03 | - | |
| Super NES Super Scope 6/ | 2021-05-15 07:00 | - | |
| Super International Cricket/ | 2008-07-08 08:28 | - | |
| Super Gussun Oyoyo 2/ | 2008-07-05 10:02 | - | |
| Super Gomoku Narabe Renju/ | 2021-05-15 07:00 | - | |
| Super Godzilla/ | 2021-05-15 07:00 | - | |
| Super Formation Soccer '95/ | 2008-07-05 10:02 | - | |
| Super Fire Pro Wrestling X Premium/ | 2008-07-08 08:28 | - | |
| Super Fire Pro Wrestling Special/ | 2008-07-08 08:27 | - | |
| Super Fire Pro Wrestling Queen's Special/ | 2008-07-08 08:25 | - | |
| Super Famista 2/ | 2021-05-15 07:00 | - | |
| Super F1 Hero/ | 2008-07-05 10:01 | - | |
| Super F1 Circus Gaiden/ | 2008-10-13 17:26 | - | |
| Super F1 Circus 3/ | 2008-10-13 17:25 | - | |
| Super F1 Circus 2/ | 2008-10-13 17:24 | - | |
| Super F1 Circus/ | 2021-05-15 07:00 | - | |
| Super Donkey Kong 3 - Nazo No Krems Shima/ | 2008-07-05 10:01 | - | |
| Super Donkey Kong 2 - Dixie & Diddy/ | 2008-07-05 10:01 | - | |
| Super Chinese Fighter/ | 2008-07-05 10:00 | - | |
| Super Buster Bros/ | 2008-07-05 10:00 | - | |
| Super Bowling/ | 2021-05-15 07:00 | - | |
| Super Bombliss/ | 2021-05-15 07:00 | - | |
| Super Black Bass 3/ | 2008-07-05 10:00 | - | |
| Super Bikkuriman/ | 2008-07-05 10:00 | - | |
| Super Alfred Chicken/ | 2008-07-05 10:00 | - | |
| Strike Gunner/ | 2008-07-05 10:00 | - | |
| Street Combat/ | 2021-05-15 07:00 | - | |
| Star Trek Deep Space Nine - The Crossroads Of Time/ | 2021-05-15 07:00 | - | |
| Star Trek - The Next Generation - Future's Past/ | 2008-07-05 09:59 | - | |
| St. Giga 10gatsu Gou/ | 2021-05-15 07:00 | - | |
| St. Andrews - Eikou to Rekishi no Old Course/ | 2008-10-13 17:24 | - | |
| Sports Illustrated Championship Football & Baseball/ | 2021-05-15 07:00 | - | |
| Spirou/ | 2008-07-05 09:59 | - | |
| Spellcraft/ | 2008-07-05 09:59 | - | |
| Speedy Gonzales - Los Gatos Bandidos/ | 2008-07-05 09:59 | - | |
| Space Invaders (SGB)/ | 2009-11-15 09:22 | - | |
| Sousa Sentai Wappers/ | 2009-11-08 16:41 | - | |
| Soul Blade/ | 2021-05-15 07:00 | - | |
| Soul & Sword/ | 2008-09-18 15:15 | - | |
| Sougou Kakutougi Rings - Astral Bout 3/ | 2008-10-13 17:23 | - | |
| Sotsugyou Bangai-hen - Nee Mahjong Shiyo!/ | 2008-10-13 17:20 | - | |
| Soreyuke Ebisumaru Karakuri Meiro - Kieta Goemon No Nazo!!/ | 2008-07-05 09:59 | - | |
| Sonic Wings/ | 2019-08-17 06:49 | - | |
| Sonic The Hedgehog/ | 2008-07-05 09:58 | - | |
| Snoopy Concert/ | 2021-05-15 07:00 | - | |
| Slayers/ | 2021-05-15 07:00 | - | |
| Slam Dunk 2 - IH Yosen Kanzenhan!!/ | 2008-07-08 08:25 | - | |
| Slam Dunk - Yonkyo Taiketsu!!/ | 2008-07-08 08:24 | - | |
| Sim Earth - The Living Planet/ | 2008-07-05 09:58 | - | |
| Side Pocket/ | 2021-05-15 07:00 | - | |
| Shonen Ashibe/ | 2021-05-15 07:00 | - | |
| Shinzui Taikyoku Igo Go Sennin/ | 2008-07-05 09:57 | - | |
| Shin Seikoku - La Wares/ | 2021-05-15 07:00 | - | |
| Shin SD Sengokuden - Taisho Gun Retsuden/ | 2008-07-05 09:57 | - | |
| Shin Majan/ | 2008-07-05 09:57 | - | |
| Shijou Saikyou League Serie A - Ace Striker/ | 2008-10-13 17:19 | - | |
| Shanghai 2 - Dragon's Eye/ | 2021-05-15 07:00 | - | |
| Shadow Of The Beast/ | 2008-07-05 09:57 | - | |
| Sengoku Denshou/ | 2008-10-13 17:19 | - | |
| Seifuku Densetsu - Pretty Fighter/ | 2008-07-05 09:57 | - | |
| Secret Of The Stars/ | 2008-07-05 09:57 | - | |
| Secret Of Mana/ | 2008-07-05 09:56 | - | |
| Saturday Night Slam Masters/ | 2008-07-05 09:56 | - | |
| Satellaview BS-X/ | 2021-05-15 07:00 | - | |
| Sargeant Saunder's Combat!/ | 2008-10-13 17:18 | - | |
| Sanrio Shanghai/ | 2008-07-05 09:56 | - | |
| Sangokushi IV/ | 2008-07-05 09:56 | - | |
| Sangokushi III/ | 2008-07-05 09:56 | - | |
| Sandra No Daibouken - Valkyrie To No Deai/ | 2008-07-05 09:55 | - | |
| Samurai Spirits/ | 2008-07-05 09:55 | - | |
| Same Game/ | 2008-07-05 09:55 | - | |
| Saikyo Takada Nobuhiko/ | 2008-10-13 17:18 | - | |
| Saibara Reiko No Mahjong Hourouki/ | 2008-10-13 17:17 | - | |
| SNES Trainer Charts/ | 2008-07-05 09:55 | - | |
| SNES Test Program/ | 2021-05-15 07:00 | - | |
| SD Kidou Senshi Gundam 2/ | 2008-07-05 09:55 | - | |
| SD Hiryu No Ken/ | 2021-05-15 07:00 | - | |
| SD Gundam Generation/ | 2008-07-05 09:55 | - | |
| SD Gundam G-Next/ | 2021-05-15 07:00 | - | |
| Ryuuko No Ken 2/ | 2008-07-05 09:54 | - | |
| Rushing Beat Shura/ | 2008-07-05 09:54 | - | |
| Rushing Beat Ran - Fukusei Toshi/ | 2008-07-05 09:54 | - | |
| Rushing Beat/ | 2008-07-05 09:54 | - | |
| Rocky Rodent/ | 2008-07-05 09:54 | - | |
| Rocko's Modern Life - Spunky's Dangerous Day/ | 2021-05-15 07:00 | - | |
| Rockman X2/ | 2008-07-05 09:53 | - | |
| Robotrek/ | 2008-07-05 09:53 | - | |
| Road Runner's Death Valley Rally/ | 2021-05-15 07:00 | - | |
| Rise Of The Phoenix/ | 2008-07-05 09:53 | - | |
| Rhi Roller Hockey '95/ | 2008-07-05 09:53 | - | |
| Rex Ronan - Experimental Surgeon/ | 2021-05-15 07:00 | - | |
| Ren & Stimpy - Buckeroo$/ | 2008-07-05 09:53 | - | |
| Realm/ | 2021-05-15 07:00 | - | |
| Rap Basketball/ | 2008-07-05 09:53 | - | |
| Ranma Nibunnoichi/ | 2008-07-05 09:53 | - | |
| Ranma Nibunnoichi - Ougi Jaanken/ | 2021-05-15 07:00 | - | |
| Ranma Nibunnoichi - Chougi Ranbu Hen/ | 2008-07-05 09:53 | - | |
| Radical Rex/ | 2008-07-05 09:53 | - | |
| RPG Tsukuru - Super Dante/ | 2008-07-05 09:53 | - | |
| Puzzle'n Desu!/ | 2008-10-13 17:14 | - | |
| Psycho Dream/ | 2008-07-05 09:52 | - | |
| Pro Yakyuu Nettou - Puzzle Stadium/ | 2008-10-13 17:11 | - | |
| Pro Quarterback/ | 2021-05-15 07:00 | - | |
| Pro Mahjong Kiwame GB (SGB)/ | 2009-11-15 09:19 | - | |
| Power Instinct/ | 2008-07-05 09:52 | - | |
| Power Athlete/ | 2008-07-05 09:52 | - | |
| Popoitto Hebereke/ | 2021-05-15 07:00 | - | |
| Poko Nyan! Yume No Daibouken (SGB)/ | 2018-01-02 16:08 | - | |
| Pokemon/ | 2008-07-05 09:51 | - | |
| Poi Poi Ninja World/ | 2008-07-05 09:51 | - | |
| Pit Fighter/ | 2008-07-05 09:51 | - | |
| Panic In Nakayoshi World/ | 2008-07-05 09:51 | - | |
| Paladin's Quest/ | 2008-07-05 09:51 | - | |
| Pachi Slot Kanzen Kouryaku - Shindai Nyuka Vol. 1/ | 2008-10-13 17:10 | - | |
| Pac Elintodo/ | 2008-07-05 09:51 | - | |
| Pac-Man/ | 2008-07-05 09:51 | - | |
| Pac-Attack/ | 2021-05-15 07:00 | - | |
| Out Of Bounds Golf/ | 2021-05-15 07:00 | - | |
| Osu!! Karatebu/ | 2008-10-13 17:09 | - | |
| Oscar/ | 2021-05-15 07:00 | - | |
| Operation Logic Bomb/ | 2008-07-05 09:50 | - | |
| Onizuka Katsuya Super Virtual Boxing/ | 2008-07-05 09:50 | - | |
| On The Ball/ | 2008-07-05 09:50 | - | |
| Ogre Battle - The March of the Black Queen/ | 2021-05-15 07:00 | - | |
| Obitus/ | 2021-05-15 07:00 | - | |
| Nuke/ | 2008-07-05 09:50 | - | |
| Nolan Ryan's Baseball/ | 2008-07-05 09:50 | - | |
| Nintendo Power Menu Program/ | 2021-05-15 07:00 | - | |
| Nintama Rantarou Puzzle - Ninjutsu Gakuen Puzzle no Maki/ | 2008-10-13 17:05 | - | |
| Nintama Rantarou 2/ | 2008-10-13 17:05 | - | |
| Nintama Rantarou/ | 2008-10-13 17:08 | - | |
| Nigel Mansell's World Championship Racing/ | 2008-07-05 09:50 | - | |
| Nichibutsu Arcade Classics 2 - Heiankyo Alien/ | 2009-11-15 09:19 | - | |
| Nichibutsu Arcade Classics/ | 2021-05-15 07:00 | - | |
| New Yattaaman - Nanndai Kanndai Yajirobe/ | 2008-10-13 17:03 | - | |
| Nekketsu! Beach Volley Dayo Kunio-kun (SGB)/ | 2009-11-08 16:38 | - | |
| Natsuki Crisis Battle/ | 2008-10-13 17:02 | - | |
| Nakajima Satoru Kanshuu F-1 Hero/ | 2008-10-13 17:01 | - | |
| Nakajima Satoru Kanshuu F-1 Hero '94/ | 2008-10-13 16:59 | - | |
| NBA Jam Tournament Edition/ | 2021-05-15 07:00 | - | |
| NBA Jam/ | 2021-05-15 07:00 | - | |
| Mystic Quest Legend/ | 2008-07-05 09:49 | - | |
| Mystery Circle/ | 2021-05-15 07:00 | - | |
| Mutant Chronicles - Doom Troopers/ | 2008-07-05 09:49 | - | |
| Multi Play Volleyball/ | 2009-11-15 09:18 | - | |
| Motoko-chan No Wonder Kitchen/ | 2021-05-15 07:00 | - | |
| Monster Maker 3 - Hikari No Majyutsushi/ | 2008-10-13 16:58 | - | |
| Monopoly - Western Version/ | 2008-07-05 09:48 | - | |
| Mini Yonku Shining Scorpion - Let's & Go!!/ | 2009-11-15 09:18 | - | |
| Mighty Max/ | 2008-07-05 09:48 | - | |
| Might And Magic III - Isles Of Terra/ | 2008-07-05 09:48 | - | |
| Might And Magic II - Gates To Another World/ | 2008-07-05 09:48 | - | |
| Mickey To Minnie - Magical Adventure 2/ | 2008-07-05 09:48 | - | |
| Megaman Soccer/ | 2008-07-05 09:48 | - | |
| Mega Man X3/ | 2008-07-05 09:47 | - | |
| Mega Man X2/ | 2008-07-05 09:47 | - | |
| Mega Man X/ | 2008-07-05 09:47 | - | |
| Mega-Lo-Mania - Jikuu Daisenryaku/ | 2008-09-18 15:13 | - | |
| Marvel Super Heroes In War Of The Gems/ | 2008-07-08 08:22 | - | |
| Makeruna! Makendou 2/ | 2008-07-05 09:46 | - | |
| Mahou Poi Poi Poitto!/ | 2008-09-18 15:13 | - | |
| Mahjong Club/ | 2021-05-15 07:00 | - | |
| Magical Pop'n/ | 2008-07-05 09:46 | - | |
| Lord Monarch/ | 2018-01-02 16:08 | - | |
| Little Magic/ | 2008-07-05 09:46 | - | |
| Liberty Or Death/ | 2021-05-15 07:00 | - | |
| Let's Pachinko Nante Gindama/ | 2008-07-05 09:45 | - | |
| Lemmings 2 - The Tribes/ | 2008-07-05 09:45 | - | |
| Lemmings/ | 2008-07-05 09:45 | - | |
| Last Action Hero/ | 2021-05-15 06:59 | - | |
| Larry Nixon's Super Bass Fishing/ | 2008-07-05 09:45 | - | |
| Kunio No Oden/ | 2008-09-18 15:13 | - | |
| Koutetsu No Kishi 3 - Gekitou Europe Sensen/ | 2008-07-20 08:04 | - | |
| Koushien 2/ | 2021-05-15 06:59 | - | |
| Konae-chan No DokiDoki Penguin Kazoku/ | 2021-05-15 06:59 | - | |
| Kirby No Kirakira Kids/ | 2008-07-05 09:45 | - | |
| Kirby Bowl/ | 2008-07-05 09:45 | - | |
| Kinnikuman - Dirty Challenger/ | 2008-09-18 15:13 | - | |
| King Of The Monsters/ | 2021-05-15 06:59 | - | |
| Kenyuu Densetsu Yaiba/ | 2021-05-15 06:59 | - | |
| Keiba Eight Special/ | 2008-07-05 09:44 | - | |
| Keiba Eight Special - Maru Hi Baken Kounyuu Jutsu/ | 2008-09-18 15:12 | - | |
| Kawa No Nushi Tsuri 2/ | 2021-05-15 06:59 | - | |
| Kat's Run - Zen Nihon K Car Senshuken/ | 2008-07-05 09:44 | - | |
| Kamen Rider SD - Shutsugeki!! Rider Machine/ | 2008-07-05 09:44 | - | |
| Kamen Rider/ | 2008-07-05 09:44 | - | |
| Kamaitachi No Yoru/ | 2008-07-05 09:43 | - | |
| Jurassic Park/ | 2008-07-05 09:43 | - | |
| Jungle No Ouja Taachan - Sekai Manyuu Dai Kakutou No Maki/ | 2021-05-15 06:59 | - | |
| Joshi Pro Wrestling - Pure Wrestle Queens/ | 2008-07-05 09:43 | - | |
| Jissen Pachi Slot Hisshouhou! Yamasa Densetsu/ | 2008-09-18 15:11 | - | |
| Jissen Pachi Slot Hisshouhou! Twin 2/ | 2008-09-18 15:10 | - | |
| Jissen Pachi Slot Hisshouhou! Twin/ | 2008-09-18 15:10 | - | |
| Jissen Pachi Slot Hisshouhou! Classic/ | 2008-09-18 15:09 | - | |
| Jissen Pachi Slot Hisshouhou! 2/ | 2008-09-18 15:09 | - | |
| Jissen Pachi Slot Hisshouhou!/ | 2008-09-18 15:11 | - | |
| Jikkyou World Soccer - Perfect Eleven/ | 2008-07-05 09:43 | - | |
| Jikkyou Powerful Pro Yakyuu 3/ | 2021-05-15 06:59 | - | |
| Jeopardy!/ | 2021-05-15 06:59 | - | |
| Jammit/ | 2008-09-18 15:08 | - | |
| James Pond 3 - Operation Starfish/ | 2008-07-05 09:43 | - | |
| Jaleco Rally Big Run - The Supreme 4WD Challenge/ | 2021-05-15 06:59 | - | |
| Jaki Crush/ | 2021-05-15 06:59 | - | |
| JWP Joshi Pro Wrestling - Pure Wrestle Queens/ | 2008-09-18 15:08 | - | |
| J. League Excite Stage '95/ | 2008-09-18 15:07 | - | |
| J. League Excite Stage '94/ | 2008-07-05 09:42 | - | |
| Izzy's Quest For The Olympic Rings/ | 2008-07-05 09:42 | - | |
| Itoi Shigesato No Bass Tsuri No.1/ | 2008-07-05 09:42 | - | |
| Itadaki Street 2 - Neon Sign Wa Bara Iro Ni/ | 2008-07-05 09:42 | - | |
| Inspector Gadget/ | 2008-07-05 09:41 | - | |
| Incantation/ | 2008-07-05 09:41 | - | |
| Hysteria/ | 2008-07-05 09:41 | - | |
| Hyper V-Ball/ | 2021-05-15 06:59 | - | |
| Hungry Dinosaurs/ | 2008-07-05 09:41 | - | |
| Humans/ | 2021-05-15 06:59 | - | |
| Human Grand Prix/ | 2021-05-15 06:59 | - | |
| Honke Sankyo Fever - Jikki Simulation 3/ | 2008-09-18 15:06 | - | |
| Honke Sankyo Fever - Jikki Simulation 2/ | 2008-09-18 15:05 | - | |
| Honkaku Shougi - Fuuunji Ryuuou/ | 2021-05-15 06:59 | - | |
| Hokuto No Ken 6/ | 2021-05-15 06:59 | - | |
| Hisshou! Pachi-Slot Fan/ | 2008-09-18 15:04 | - | |
| Hissatsu Pachinko Collection/ | 2008-09-18 15:04 | - | |
| Heiwa Parlor! Mini 8 - Pachinko Jikki Simulation Game/ | 2008-07-05 09:41 | - | |
| Hatayama Hachi no Paro Yakyu News Jitsmeiban/ | 2008-07-05 09:41 | - | |
| Hashire Hebereke/ | 2008-07-05 09:40 | - | |
| Harapeko Bakka/ | 2008-07-05 09:40 | - | |
| Hanna Barbera's Turbo Toons/ | 2008-07-05 09:40 | - | |
| Hana No Keiji - Kumo No Kanata Ni/ | 2008-09-18 15:04 | - | |
| Haisei Mahjong Ryouga/ | 2009-11-15 09:16 | - | |
| Gunman's Proof/ | 2021-05-15 06:59 | - | |
| Gundam Wing - Endless Duel/ | 2008-08-14 07:54 | - | |
| Great Battle Gaiden 2/ | 2021-05-15 06:59 | - | |
| Gouketuji Ichizoku/ | 2008-07-05 09:39 | - | |
| Goods Press Gatsu Gou Series/ | 2009-11-15 09:16 | - | |
| Gon/ | 2008-09-18 15:03 | - | |
| Gekitou Burning Pro Wrestling/ | 2008-07-08 08:21 | - | |
| Gegege No Kitarou - Youkai Donjara/ | 2008-07-05 09:39 | - | |
| Game No Tetsujin - The Shanghai/ | 2008-07-13 07:49 | - | |
| Game Genie/ | 2021-05-15 06:59 | - | |
| Gambler Jiko Chuushinha 2 - Dorapon Quest/ | 2008-07-05 09:39 | - | |
| Gamble Hourouki/ | 2009-11-15 09:16 | - | |
| Gamars Copier/ | 2021-05-15 06:59 | - | |
| Galaxy Wars/ | 2021-05-15 06:59 | - | |
| GS Mikami - Joreishi Ha Nice Body/ | 2008-07-05 09:39 | - | |
| GP-1/ | 2021-05-15 06:59 | - | |
| Fun 'N Games/ | 2008-07-05 09:38 | - | |
| From Tv Animation Slam Dunk 2 - Ih Yosen Kanzenhan!!/ | 2008-07-05 09:38 | - | |
| From Tv Animation Slam Dunk - Shikyou Gekitotsu!!/ | 2008-07-05 09:38 | - | |
| Frogger/ | 2021-05-15 06:59 | - | |
| Frantic Flea/ | 2008-07-05 09:38 | - | |
| Flying Hero - Bugyuru No Daibouken/ | 2008-07-05 09:38 | - | |
| First Samurai/ | 2021-05-15 06:59 | - | |
| Firepower 2000/ | 2008-07-05 09:38 | - | |
| Fire Pro Joshi All Star Dream Slam/ | 2008-07-08 08:20 | - | |
| Final Fight 3/ | 2008-07-05 09:38 | - | |
| Final Fight 2/ | 2008-07-05 09:37 | - | |
| Faceball 2000/ | 2008-07-05 09:37 | - | |
| F-Zero Grand Prix 2/ | 2008-07-05 09:37 | - | |
| F-1 Grand Prix Part III/ | 2021-05-15 06:59 | - | |
| F-1 Grand Prix Part II/ | 2021-05-15 06:59 | - | |
| Eye Of The Beholder/ | 2019-08-17 06:49 | - | |
| Extra Innings/ | 2008-07-05 09:37 | - | |
| Excitebike Bun Bun Mario Battle Stadium/ | 2009-11-15 09:15 | - | |
| Elite Soccer/ | 2008-07-05 09:37 | - | |
| Eien No Filena/ | 2008-07-05 09:37 | - | |
| Earth Light/ | 2008-07-05 09:36 | - | |
| Drift King - Shutokou Battle 2/ | 2008-07-05 09:36 | - | |
| Dream Basketball - Dunk & Hoop/ | 2008-07-08 08:19 | - | |
| Dragon Slayer - Eiyuu Densetsu II/ | 2018-01-02 16:08 | - | |
| Dragon Slayer - Eiyuu Densetsu 2/ | 2008-09-18 15:03 | - | |
| Dragon Ball Z - Super Gokuden - Totsugeki-Hen/ | 2019-08-24 07:16 | - | |
| Dragon Ball Z - Super Gokuden - Kakusei-Hen/ | 2019-08-24 07:16 | - | |
| Dragon Ball Z - Hyper Dimension/ | 2021-05-15 06:59 | - | |
| Dragon's Earth/ | 2008-07-05 09:36 | - | |
| Downtown Nekketsu Baseball Monogatari - Baseball De Shoufuda! Kunio-Kun/ | 2008-07-05 09:35 | - | |
| Double Dragon 5/ | 2008-07-05 09:35 | - | |
| Dossun! Ganseki Battle/ | 2021-05-15 06:59 | - | |
| Doomsday Warrior/ | 2008-07-05 09:35 | - | |
| Dirt Trax FX/ | 2008-07-05 09:35 | - | |
| Dino City/ | 2008-08-14 07:54 | - | |
| Dimension Force/ | 2021-05-15 06:59 | - | |
| Dharma Doujou/ | 2008-07-13 07:49 | - | |
| Desert Strike - Return To The Gulf/ | 2008-07-05 09:35 | - | |
| Dennis The Menace/ | 2008-07-05 09:34 | - | |
| Demon's Crest/ | 2008-07-05 09:34 | - | |
| Dekitate High School/ | 2008-07-08 08:18 | - | |
| Daze Before Christmas/ | 2008-07-05 09:34 | - | |
| Dark Kingdom/ | 2021-05-15 06:59 | - | |
| Daikaijuu Monogatari 2/ | 2008-09-17 14:33 | - | |
| D-Force/ | 2008-07-05 09:34 | - | |
| Cynix 2nd Demo/ | 2008-07-05 09:34 | - | |
| Cyborg 009/ | 2021-05-15 06:59 | - | |
| Cosmo Gang/ | 2008-07-05 09:34 | - | |
| Conveni Wars - Barcode Battler Senki - Super Senshi Shutsugeki seyo!/ | 2009-11-15 09:15 | - | |
| Controller Test Cartridge/ | 2021-05-15 06:59 | - | |
| Computer Nouryoku Kaiseki Ultra Baken/ | 2021-05-15 06:59 | - | |
| Clue/ | 2021-05-15 06:59 | - | |
| Civilization/ | 2021-05-15 06:59 | - | |
| Choujikuu Yousai Macross - Scrambled Valkyrie/ | 2008-07-05 09:33 | - | |
| Chibi Maruko-Chan - Mezase! Minami No Island!!/ | 2008-07-05 09:33 | - | |
| Chester Cheetah - Wild Wild Quest/ | 2021-05-15 06:59 | - | |
| Chester Cheetah - Too Cool To Fool/ | 2008-07-05 09:33 | - | |
| Caravan Shooting Collection/ | 2021-05-15 06:59 | - | |
| Capcom's Soccer Shootout/ | 2008-09-17 14:32 | - | |
| Bust-A-Move/ | 2008-07-05 09:31 | - | |
| Burai - Hachigyoku No Yuushi Densetsu/ | 2021-05-15 06:59 | - | |
| Brutal Paws Of Fury/ | 2008-07-05 09:31 | - | |
| Breath Of Fire/ | 2008-07-05 09:31 | - | |
| Bram Stoker's Dracula/ | 2021-05-15 06:59 | - | |
| Bishoujo Senshi Sailor Moon Super S - Fuwa Fuwa Panic/ | 2021-05-15 06:59 | - | |
| Bishoujo Senshi Sailor Moon S - Fuwa Fuwa Panic 2/ | 2008-07-05 09:28 | - | |
| Bill Laimbeer's Combat Basketball/ | 2021-05-15 06:59 | - | |
| Battle Robot Retsuden/ | 2008-09-17 14:31 | - | |
| Battle Cross/ | 2021-05-15 06:59 | - | |
| Bastard!! - Ankoku No Hakai-Shin/ | 2021-05-15 06:59 | - | |
| Barbie Vacation Adventure/ | 2021-05-15 06:59 | - | |
| Barbarossa/ | 2021-05-15 06:59 | - | |
| Ballz 3D/ | 2021-05-15 06:59 | - | |
| Bakumatsu Kourinden Oni/ | 2008-09-17 14:31 | - | |
| Bakukyuu Renpatsu!! Super B-Daman/ | 2008-07-13 07:49 | - | |
| BS Nintama Rantarou 2/ | 2008-09-17 14:30 | - | |
| BS Nichibutsu Mahjong/ | 2021-05-15 06:59 | - | |
| Ashita No Joe/ | 2021-05-15 06:59 | - | |
| Asahi Shinbun Rensai/ | 2019-08-24 07:16 | - | |
| Angelique Voice Fantasy/ | 2008-08-17 17:50 | - | |
| Angelique/ | 2008-09-17 14:29 | - | |
| American Battle Dome/ | 2021-05-15 06:59 | - | |
| Akagawa Jirou - Majo-tachi No Nemuri/ | 2009-11-15 09:14 | - | |
| Air Management 2/ | 2021-05-15 06:59 | - | |
| Air Management/ | 2021-05-15 06:59 | - | |
| Aging Cassette/ | 2019-08-24 07:16 | - | |
| Aero The Acro-Bat 2/ | 2021-05-15 06:59 | - | |
| Aero The Acro-Bat/ | 2021-05-15 06:59 | - | |
| A Ressha De Ikou 3 Super Version/ | 2021-05-15 06:59 | - | |
| 4 Nin Shogi/ | 2021-05-15 06:59 | - | |
| 3x3 Eyes - Juuma Houkan/ | 2019-08-24 07:16 | - | |
| - misc/ | 2018-01-02 16:08 | - | |
|
|---|